Skip to content
🎉 DeepSeek-R1 🥳
❓Implement a 3D matrix (three-dimensional array) in Python, and include functions to add, remove, and access elements in this matrix. The implementation should handle correctness and error checking where needed. Make sure your solution follows good programming practices.

💡Okay, I need to implement a 3D matrix in Python with functions to add, remove, and access elements. Hmm, where do I start?First, I should think about how to represent a 3D matrix. Maybe as a list of lists of lists. So, something like [[[...], [...]], ...]. That makes sense.Next, I need functions for adding, removing, and accessing elements. Let's break them down.For adding, I'll need to specify the position (i, j, k). I should check if the indices are within the current dimensions. If they are, replace the value. If not, maybe expand the matrix. Wait, expanding could be tricky. For example, if i is beyond the current depth, I need to add new layers. Same for j and k. I have to handle each dimension step by step.When accessing, I need to make sure the indices are valid. If any index is out of bounds, raise an error.Removing elements... Hmm, what does that mean? Maybe setting the value to None or removing the element and shifting others? But in a 3D list, removing an element might cause the structure to become irregular. Maybe it's better to set it to None and allow the user to handle it, or perhaps remove the element and adjust the dimensions. That could get complicated. Maybe for simplicity, the remove function just sets the element to None and doesn't alter the structure.Wait, but the user might expect the matrix to stay the same size. So perhaps the remove function just sets the element to a default value, like None, without changing the dimensions. That way, the structure remains consistent.Now, considering error checking. For all functions, I need to ensure that the indices are integers and within the valid range. Also, when adding, if the indices are out of bounds, I need to expand the matrix correctly. For example, if i is larger than the current depth, I need to add new layers until i is reached, and similarly for j and k.Let me outline the steps for the add function:1. Check if i, j, k are integers and non-negative.2. Check if i is within the current depth. If not, add new layers (lists) to the depth until i is reached.3. For each new layer added at depth i, ensure that each new layer has enough rows (j) and columns (k). So, for each new layer, if j is beyond the current rows, add new rows. Similarly, for each new row, if k is beyond the current columns, add new columns.4. Once the structure is expanded as needed, set the value at [i][j][k].Wait, but adding layers, rows, and columns could be done by initializing them with default values, maybe None or some placeholder.For the access function:1. Check if i, j, k are integers and non-negative.2. Check if i is within the depth, j within rows, and k within columns. If any are out of bounds, raise an error.3. Return the value at [i][j][k].For the remove function:1. Similar to add, check indices.2. Set the value at [i][j][k] to None or some default.3. But wait, in Python, lists are mutable, so removing an element would change the structure. Maybe it's better to just set it to None without altering the list structure. That way, the dimensions remain the same.Wait, but the user might expect that removing an element actually deletes it, which could cause the matrix to become jagged. That could complicate things. Maybe the remove function just sets the element to None, and the user can handle it if they need to adjust the structure.Alternatively, the remove function could delete the element, but that would require shifting elements, which might not be straightforward in a 3D structure. It could lead to inconsistent dimensions. So perhaps it's safer to just set it to None.Wait, but the user might expect that after removing, the element is no longer present. So maybe the remove function should delete the element, but that would require handling each dimension. For example, if we remove an element at k index, we might need to delete that column, which could affect all rows and layers. That sounds complicated and could lead to a lot of edge cases.Maybe it's better to have the remove function just set the element to None, and let the user manage the structure if they need to. Or perhaps the remove function deletes the element, but only if it's the last element in its row, otherwise, it leaves it as None. Hmm, that might not be ideal.Alternatively, perhaps the remove function is not about deleting the element but resetting it. So, for the scope of this problem, maybe the remove function just sets the value to None without altering the structure.Wait, but the user might expect that after removing, the element is gone, which could mean the matrix becomes smaller. That's a design decision. Since the problem says to include functions to add, remove, and access elements, perhaps the remove function should delete the element, which could involve modifying the structure.But that's complicated. Maybe for the sake of this problem, the remove function just sets the value to None, and the structure remains the same. That way, the matrix dimensions don't change, and it's easier to implement.Alternatively, perhaps the remove function deletes the element, but only if it's the last element in its row, column, etc., to avoid making the matrix jagged. But that's getting too complicated.I think for this problem, the remove function will set the element to None. That way, it's straightforward and doesn't alter the matrix structure.Now, thinking about the initial matrix. It should be initialized with certain dimensions. So, the __init__ method will take depth, rows, and columns, and create a 3D list filled with None or some default value.Wait, but in Python, if I initialize it with [[[None for _ in range(cols)] for _ in range(rows)] for _ in range(depth)], that would create a 3D matrix filled with None.So, the __init__ method will take depth, rows, cols, and create this structure.Now, for the add function, if the indices are beyond the current dimensions, we need to expand the matrix. For example, if i is larger than the current depth, we need to add new layers. Each new layer should have rows rows, each with cols columns, initialized to None. Then, within that new layer, if j is beyond the current rows, add new rows, each with cols columns. Similarly for k.Wait, but when adding a new layer, it's a new list of rows, each row is a list of columns. So, for each new layer beyond the current depth, we add a new list with rows rows, each row has cols elements.Similarly, if within a layer, j is beyond the current rows, we add new rows, each with cols elements.And within a row, if k is beyond the current columns, we add new columns.Wait, but in Python, lists are dynamic, so perhaps we can handle this by checking the length of each dimension and expanding as needed.So, the add function will:- Check if i is within 0 to len(matrix)-1. If not, expand the matrix by adding new layers until i is within bounds.- For each new layer added, it should have rows rows, each with cols columns, initialized to None.Wait, but if the matrix is supposed to have fixed dimensions, then adding beyond those would cause it to expand. But in the __init__, we set the initial dimensions. So, perhaps the matrix can dynamically expand beyond the initial dimensions.Wait, but in the __init__, we set the initial size. So, the matrix starts with depth x rows x cols. But when adding elements beyond that, it should expand.So, for example, if the initial matrix is 2x2x2, and we add an element at (2,0,0), it should add a new layer, making it 3x2x2.Similarly, if we add at (0,2,0), it should add a new row in the first layer, making it 2x3x2.And adding at (0,0,2) would add a new column in the first row of the first layer, making it 2x2x3.So, the add function needs to handle expanding each dimension as needed.This could be done by checking each dimension step by step.So, in code:def add(self, i, j, k, value): # Check if i, j, k are integers and non-negative if not isinstance(i, int) or not isinstance(j, int) or not isinstance(k, int): raise TypeError("Indices must be integers.") if i < 0 or j < 0 or k < 0: raise ValueError("Indices must be non-negative.") # Check and expand depth while i >= len(self.matrix): # Add a new layer new_layer = [] for _ in range(self.rows): new_row = [None] * self.cols new_layer.append(new_row) self.matrix.append(new_layer) # After adding, check if i is still out of bounds # Because if i was equal to len(matrix), now it's within # So, break the loop break # Wait, no, because if i is larger than len(matrix), we need to add multiple layers?Wait, no. Because if i is 5 and len(matrix) is 2, we need to add 3 layers (indices 2,3,4) to make len(matrix) 5.Wait, no. Because initially, len(matrix) is 2 (indices 0 and 1). If i is 5, we need to add 3 more layers (indices 2,3,4), making len(matrix) 5. So, the loop should run while i >= len(matrix).Wait, but in the code above, the loop is while i >= len(self.matrix): add a new layer. But each iteration adds one layer. So, if i is 5 and len is 2, the loop runs 3 times, adding layers 2,3,4, making len 5. Then, i (5) is equal to len(matrix) (5), so the loop condition is i >= len, which is 5 >=5, so it runs again, adding another layer, making len 6. Now, i=5 is less than len=6, so loop exits.Wait, that's a problem. Because if i is 5, and len is 2, we need to add 3 layers to reach len 5. But the loop as written would add 4 layers, making len 6, which is beyond i.So, perhaps the condition should be while i >= len(self.matrix). Because when i is 5 and len is 2, we need to add 3 layers (indices 2,3,4), making len 5. Then, i=5 is equal to len=5, so the loop runs again, adding another layer, making len 6. That's not desired.Wait, perhaps the condition should be while i >= len(self.matrix). Because when i is 5 and len is 2, we need to add 3 layers to make len 5. So, the loop should run 3 times.Wait, no. Because in each iteration, we add one layer. So, starting with len=2, after first iteration, len=3. Second, len=4. Third, len=5. Now, i=5 is equal to len=5, so the loop condition is true again, and we add another layer, making len=6. That's not correct.So, perhaps the condition should be while i >= len(self.matrix). Because when i is 5 and len is 5, we don't need to add another layer. So, perhaps the loop should run while i >= len(self.matrix). Because when len is 5, i=5 is equal, so we add another layer, making len 6. That's not desired.Wait, perhaps the condition should be while i >= len(self.matrix). Because when i is 5 and len is 5, we don't need to add a layer. So, the loop should run only when i > len(self.matrix). Because if i is equal to len, it's already within bounds.Wait, no. Because len(matrix) is the current number of layers. So, the valid indices are 0 to len(matrix)-1. So, if i is equal to len(matrix), it's out of bounds. So, the condition should be while i >= len(self.matrix). Because if i is 5 and len is 5, it's out of bounds, so we need to add a layer.Wait, but in that case, adding a layer when i is equal to len(matrix) would make len(matrix) = i +1, which is correct.Wait, let's think with an example:Initial len(matrix) = 2 (indices 0,1).i=2: len(matrix) is 2, so i >= len is true. Add a layer, len becomes 3. Now, i=2 is within 0-2, so loop exits.i=3: len is 3, so i >= len is true. Add a layer, len becomes4. Now, i=3 is within 0-3, loop exits.So, the loop correctly adds layers until i is within bounds.So, the condition is correct.So, in the add function, first, check if i is beyond the current depth. If so, add new layers until i is within bounds.Each new layer is a list of rows, each row is a list of cols, initialized to None.Wait, but in the __init__, self.rows and self.cols are set. So, when adding new layers, rows and cols are fixed. So, each new layer has self.rows rows, each with self.cols columns.But wait, what if the matrix is supposed to be dynamic in all dimensions? Like, after adding a new layer, the rows and cols could change? Or are they fixed as per the initial __init__?I think in this problem, the initial dimensions are set, and when adding beyond them, the matrix expands, but the rows and cols per layer are fixed as per __init__. So, each new layer has self.rows rows and self.cols columns.So, in the add function, when adding a new layer, it's a list of self.rows rows, each row is a list of self.cols elements, initialized to None.Similarly, when adding beyond the current rows in a layer, we add new rows with self.cols elements.And when adding beyond the current columns in a row, we add new columns.Wait, but in Python, lists are dynamic, so perhaps the rows and columns can be expanded as needed. But in this case, perhaps the matrix is supposed to have fixed row and column counts per layer. So, each layer has exactly self.rows rows, each row has exactly self.cols columns.So, when adding beyond the current rows or columns, we need to expand them, but only up to the required index.Wait, no. Because if a layer has self.rows rows, and we need to add at j=5, which is beyond self.rows, we need to add new rows until j is within bounds.But each new row should have self.cols columns.So, in code:After expanding the depth to accommodate i, we then check the layer at i. If j is beyond the current number of rows in that layer, we add new rows until j is within bounds.Similarly, for each new row added, it has self.cols columns.Then, within the row, if k is beyond the current number of columns, we add new columns until k is within bounds.Wait, but columns are per row, so each row can have a different number of columns. But in our case, perhaps all rows in a layer have the same number of columns, as per self.cols.So, when adding beyond the current columns, we need to add new columns to each row up to the required k.Wait, no. Because if we have a row with 2 columns, and we need to add at k=3, we need to add one more column to that row, making it 3 columns.But in our case, since all rows in a layer have the same number of columns, perhaps when we add a new row, it has self.cols columns, and when we add a new column, we add to all rows in the layer? Or just to the specific row?Hmm, that's a bit ambiguous. But perhaps, for simplicity, each row can have its own number of columns, but initially, they are set to self.cols. So, when adding beyond the current columns in a specific row, we only add to that row.Wait, but that would make the matrix jagged, which might not be desired. Alternatively, when adding a new column to a row, we could add it to all rows in the layer to keep them consistent.But that's more complex. For this problem, perhaps it's acceptable to have rows with varying column counts, as long as the add function correctly expands the specific row as needed.So, in the add function:After ensuring the depth is sufficient, we look at the layer at i.If j is beyond the number of rows in that layer, we add new rows until j is within bounds. Each new row has self.cols columns.Wait, but self.cols is the initial column count. So, when adding a new row, it's initialized with self.cols columns.But if the existing rows in the layer have more columns due to previous adds, then new rows would have self.cols columns, which might be less than the current max columns in the layer. That could cause inconsistency.Hmm, perhaps the initial approach is to have each row in a layer have exactly self.cols columns, and when adding beyond that, we expand each row as needed.Wait, but that's not efficient. Alternatively, perhaps each row can have its own column count, and when adding beyond the current columns in a row, we expand that row's columns.So, in code:After expanding the depth and rows, we look at the row at j in layer i.If k is beyond the number of columns in that row, we add new columns (set to None) until k is within bounds.So, for example, if the row has 2 columns and k is 3, we add one more column, making it 3.This way, each row can have its own number of columns, but initially, they are set to self.cols.This approach allows dynamic expansion of columns per row, which could lead to jagged rows, but it's manageable.So, putting it all together, the add function would:1. Check if i, j, k are valid (integers, non-negative).2. While i >= len(self.matrix), add a new layer with self.rows rows, each row has self.cols columns.3. Select the layer at i.4. While j >= len(layer), add a new row with self.cols columns.5. Select the row at j.6. While k >= len(row), append None to the row.7. Set row[k] = value.Wait, but in step 2, when adding a new layer, it's initialized with self.rows rows, each with self.cols columns. But if self.rows is the initial row count, and we've already expanded beyond that in other layers, this could cause inconsistency.Wait, no. Because self.rows is fixed as per __init__. So, each new layer added has exactly self.rows rows, each with self.cols columns.But if in another layer, rows have been expanded beyond self.rows, that's okay because each layer is independent.Wait, no. Because in the add function, when adding a new layer, it's initialized with self.rows rows. But if in another layer, rows have been expanded beyond self.rows, that's fine because each layer is separate.So, the add function correctly handles each layer's row and column expansion.Now, for the access function:def get(self, i, j, k): # Check if i, j, k are integers and non-negative if not isinstance(i, int) or not isinstance(j, int) or not isinstance(k, int): raise TypeError("Indices must be integers.") if i < 0 or j < 0 or k < 0: raise ValueError("Indices must be non-negative.") # Check if i is within depth if i >= len(self.matrix): raise IndexError("Layer index out of bounds.") layer = self.matrix[i] # Check if j is within rows if j >= len(layer): raise IndexError("Row index out of bounds.") row = layer[j] # Check if k is within columns if k >= len(row): raise IndexError("Column index out of bounds.") return row[k]Wait, but in the add function, rows and columns can be expanded beyond the initial self.rows and self.cols. So, the get function should correctly handle any valid indices within the current structure.Now, for the remove function:def remove(self, i, j, k): # Similar checks as add if not isinstance(i, int) or not isinstance(j, int) or not isinstance(k, int): raise TypeError("Indices must be integers.") if i < 0 or j < 0 or k < 0: raise ValueError("Indices must be non-negative.") # Check if i is within depth if i >= len(self.matrix): raise IndexError("Layer index out of bounds.") layer = self.matrix[i] # Check if j is within rows if j >= len(layer): raise IndexError("Row index out of bounds.") row = layer[j] # Check if k is within columns if k >= len(row): raise IndexError("Column index out of bounds.") # Set the value to None row[k] = NoneWait, but what if the user wants to actually remove the element and have the matrix adjust? That's more complex. For now, perhaps the remove function just sets the value to None, as per the problem statement.Alternatively, perhaps the remove function deletes the element, which would require adjusting the row's length. But that could cause the row to have fewer columns, which might not be desired. So, perhaps it's better to just set it to None.So, the remove function sets the element to None.Now, considering error checking:In all functions, we need to ensure that the indices are integers and non-negative. Also, in get and remove, we need to ensure that the indices are within the current structure.In the add function, we expand the structure as needed, so no need to check if the indices are within bounds before adding, because we handle expansion.Wait, no. Because in the add function, we first check if the indices are valid (integers, non-negative), then expand the structure as needed, then set the value.So, the add function doesn't raise an error if the indices are beyond the current structure, because it expands.But in get and remove, if the indices are beyond the current structure, it raises an error.Now, putting it all together, the class would have:- __init__(self, depth, rows, cols)- add(self, i, j, k, value)- get(self, i, j, k)- remove(self, i, j, k)And perhaps a __str__ method for printing.Wait, but in the add function, when expanding the layers, rows, and columns, we need to make sure that each new layer has self.rows rows, each with self.cols columns. But if self.rows is the initial row count, and in other layers, rows have been expanded beyond that, then new layers will have fewer rows than some existing layers. That's acceptable because each layer is independent.Wait, no. Because in the add function, when adding a new layer, it's initialized with self.rows rows, each with self.cols columns. So, if self.rows is 2, and in another layer, rows have been expanded to 3, the new layer will have 2 rows, which is less than 3. That's okay because each layer is separate.So, the code should handle that.Now, testing the code.Test case 1:Initialize a 2x2x2 matrix.matrix = Matrix3D(2,2,2)matrix.add(0,0,0, 1)matrix.add(0,0,1, 2)matrix.add(0,1,0, 3)matrix.add(0,1,1, 4)matrix.add(1,0,0, 5)matrix.add(1,0,1, 6)matrix.add(1,1,0, 7)matrix.add(1,1,1, 8)Then, matrix.get(0,0,0) should return 1, etc.Now, add at (2,0,0, 9). This should add a new layer at i=2, which has 2 rows, each with 2 columns. Then, set (2,0,0) to 9.So, matrix.get(2,0,0) should be 9.Similarly, add at (0,2,0, 10). This should add a new row in layer 0, which has 2 columns. So, layer 0 now has 3 rows. Then, set (0,2,0) to 10.Then, add at (0,0,2, 11). This should add a new column in row 0 of layer 0, making it 3 columns. So, row 0 now has 3 columns.So, matrix.get(0,0,2) should be 11.Now, what about removing? Let's say matrix.remove(0,0,0). Then, matrix.get(0,0,0) should return None.Yes.Now, edge cases:- Adding at i=-1: should raise ValueError.- Adding at j=-1: same.- Adding at k=-1: same.- Trying to get at i=100 when the matrix has only 3 layers: raises IndexError.Now, what about when adding beyond multiple dimensions at once? For example, adding at (5,5,5, value). The add function should expand the depth to 6 layers, each layer having 2 rows, each row having 2 columns. Then, in layer 5, add rows until j=5 is reached, each new row has 2 columns. Then, in row 5, add columns until k=5 is reached. So, row 5 will have 6 columns.Yes.Another test case:matrix = Matrix3D(1,1,1)matrix.add(0,0,0, 1)matrix.add(0,0,1, 2) # Expands row 0 to have 2 columnsmatrix.add(0,1,0, 3) # Expands layer 0 to have 2 rowsmatrix.add(1,0,0, 4) # Expands depth to 2 layersSo, matrix.get(0,1,0) should be 3, and matrix.get(1,0,0) should be 4.Yes.Now, considering the code structure.The class will have:- __init__(self, depth, rows, cols)- add(self, i, j, k, value)- get(self, i, j, k)- remove(self, i, j, k)- __str__(self) # Optional, but helpful for testingIn the __init__, we create self.matrix as a list of depth elements, each is a list of rows elements, each is a list of cols elements, initialized to None.So:self.matrix = [[[None for _ in range(cols)] for _ in range(rows)] for _ in range(depth)]But wait, in Python, if rows and cols are zero, this would create empty lists. But the problem likely assumes that depth, rows, cols are positive integers.So, in __init__, we should add checks:if depth <=0 or rows <=0 or cols <=0: raise ValueError("Dimensions must be positive integers.")Also, in __init__, ensure that depth, rows, cols are integers.So, in __init__:if not isinstance(depth, int) or not isinstance(rows, int) or not isinstance(cols, int): raise TypeError("Dimensions must be integers.")if depth <=0 or rows <=0 or cols <=0: raise ValueError("Dimensions must be positive integers.")Now, putting it all together.Wait, but in the add function, when expanding layers, rows, and columns, we use self.rows and self.cols, which are fixed as per __init__. So, each new layer has self.rows rows, each row has self.cols columns.But when adding beyond the initial rows or columns, the add function dynamically expands them.Wait, no. Because in the add function, when expanding rows, each new row is initialized with self.cols columns. So, if self.cols is 2, each new row has 2 columns, but if the existing rows in the layer have more columns due to previous adds, the new row will have only 2 columns, which is less than the others. That could cause inconsistency.Wait, that's a problem. Because if a layer has rows with varying column counts, adding a new row with self.cols columns could make it shorter than others.So, perhaps in the add function, when adding a new row, it should have the same number of columns as the maximum in the layer, or perhaps all rows in a layer should have the same number of columns, which is dynamically expanded as needed.Alternatively, perhaps when adding a new row, it should have the same number of columns as the current maximum in the layer.But that's more complex.Alternatively, perhaps the add function should ensure that all rows in a layer have the same number of columns, which is the maximum between self.cols and the current required k.Wait, perhaps the add function should, when adding a new row, set it to have the same number of columns as the current maximum in the layer.But that's more involved.Alternatively, perhaps the add function should, when adding a new row, set it to have the same number of columns as the current maximum in the layer, or self.cols, whichever is larger.But that's getting complicated.Alternatively, perhaps the add function should, when adding a new row, set it to have the same number of columns as the current maximum in the layer.But how to track that.Alternatively, perhaps each layer should track its current maximum columns, and when adding a new row, it's initialized to that maximum.But that adds more complexity.Alternatively, perhaps the add function should, when adding a new row, initialize it with the same number of columns as the current maximum in the layer, or self.cols, whichever is larger.But that's a bit involved.Alternatively, perhaps the add function should, when adding a new row, initialize it with self.cols columns, and then, if k is beyond that, expand the row's columns as needed.Wait, but that could lead to rows with varying column counts.Hmm, perhaps it's acceptable for rows to have varying column counts, as long as the add function correctly expands them as needed.So, in the add function, when adding a new row, it's initialized with self.cols columns, and then, if k is beyond that, the row is expanded.So, for example:Layer has 2 rows, each with 2 columns.Add at (0,2,3, value). So, j=2 is beyond the current rows (2 rows, indices 0 and 1). So, add a new row with 2 columns. Now, j=2 is within bounds. Then, k=3 is beyond the row's current columns (2). So, add one more column, making it 3 columns. Set row[3] = value.So, the new row has 3 columns, while the others have 2. That's acceptable, but the layer now has rows with varying column counts.Is that acceptable? It depends on the requirements. If the matrix is supposed to be a regular 3D array, then all rows in a layer should have the same number of columns. But if it's allowed to be jagged, then it's okay.In this problem, perhaps it's acceptable to have jagged rows, as the add function dynamically expands as needed.So, the code as written would handle that.Now, writing the code.Wait, but in the add function, when adding a new row, it's initialized with self.cols columns. But if the layer already has rows with more columns, the new row will have fewer columns, which could cause inconsistency.So, perhaps when adding a new row, it should be initialized with the maximum number of columns in the layer.But how to track that.Alternatively, perhaps when adding a new row, it's initialized with the same number of columns as the current maximum in the layer.So, in code:layer = self.matrix[i]current_max_cols = max(len(row) for row in layer) if layer else 0new_row = [None] * current_max_cols# Then, if k is beyond len(new_row), expand it.But that's more complex.Alternatively, perhaps when adding a new row, it's initialized with self.cols columns, and then, if k is beyond that, it's expanded.So, the row could have more columns than self.cols.So, in code:# After expanding layers to ilayer = self.matrix[i]# Expand rows to jwhile j >= len(layer): # Determine the number of columns for the new row # It should be the maximum between self.cols and the current max in the layer current_max_cols = max(len(row) for row in layer) if layer else 0 new_row_cols = max(self.cols, current_max_cols) new_row = [None] * new_row_cols layer.append(new_row)Wait, but this could lead to new rows having more columns than self.cols, which might not be desired.Alternatively, perhaps the new row is initialized with self.cols columns, and then, if k is beyond that, it's expanded.So, in code:# After expanding layers to ilayer = self.matrix[i]# Expand rows to jwhile j >= len(layer): new_row = [None] * self.cols layer.append(new_row)row = layer[j]# Now, expand columns to kwhile k >= len(row): row.append(None)row[k] = valueYes, this way, each new row starts with self.cols columns, and if k is beyond that, it's expanded. So, rows can have more columns than self.cols, but not fewer.This ensures that all rows in a layer have at least self.cols columns, but can have more.So, in the add function, when adding a new row, it's initialized with self.cols columns. Then, if k is beyond that, the row is expanded.This approach keeps the rows in a layer consistent in terms of having at least self.cols columns, but allows them to have more if needed.So, the code for the add function would be:def add(self, i, j, k, value): if not isinstance(i, int) or not isinstance(j, int) or not isinstance(k, int): raise TypeError("Indices must be integers.") if i < 0 or j < 0 or k < 0: raise ValueError("Indices must be non-negative.") # Expand depth while i >= len(self.matrix): # Add a new layer with self.rows rows, each with self.cols columns new_layer = [] for _ in range(self.rows): new_row = [None] * self.cols new_layer.append(new_row) self.matrix.append(new_layer) layer = self.matrix[i] # Expand rows in the layer while j >= len(layer): # Add a new row with self.cols columns new_row = [None] * self.cols layer.append(new_row) row = layer[j] # Expand columns in the row while k >= len(row): row.append(None) # Set the value row[k] = valueYes, this should handle all cases correctly.Now, testing this code.Test case:matrix = Matrix3D(1,1,1)matrix.add(0,0,0, 1) # OKmatrix.add(0,0,1, 2) # Expands row 0 to have 2 columnsmatrix.add(0,1,0, 3) # Expands layer 0 to have 2 rows. New row has 1 column (self.cols=1), but then k=0 is within, so no expansion.matrix.add(1,0,0, 4) # Expands depth to 2 layers. Layer 1 has 1 row, 1 column. Set (1,0,0)=4.matrix.add(1,0,1, 5) # Expands row 0 in layer 1 to have 2 columns.matrix.add(1,1,0, 6) # Expands layer 1 to have 2 rows. New row has 1 column, then k=0 is within.So, matrix.get(0,1,0) should be 3, and matrix.get(1,1,0) should be 6.Yes.Another test case:matrix = Matrix3D(2,2,2)matrix.add(0,0,2, 10) # Expands row 0 in layer 0 to have 3 columns.matrix.add(0,2,0, 20) # Expands layer 0 to have 3 rows. New row has 2 columns, then k=0 is within.matrix.add(2,0,0, 30) # Expands depth to 3 layers. Layer 2 has 2 rows, each with 2 columns. Set (2,0,0)=30.Yes.Now, the remove function:def remove(self, i, j, k): if not isinstance(i, int) or not isinstance(j, int) or not isinstance(k, int): raise TypeError("Indices must be integers.") if i < 0 or j < 0 or k < 0: raise ValueError("Indices must be non-negative.") if i >= len(self.matrix): raise IndexError("Layer index out of bounds.") layer = self.matrix[i] if j >= len(layer): raise IndexError("Row index out of bounds.") row = layer[j] if k >= len(row): raise IndexError("Column index out of bounds.") row[k] = NoneYes, this sets the element to None without altering the structure.Now, the __str__ method could be helpful for debugging, but it's not required for the problem. But including it could make testing easier.So, perhaps:def __str__(self): return str(self.matrix)But that would print the entire 3D list, which could be messy. Alternatively, format it more neatly.But for the sake of this problem, perhaps it's sufficient.Putting it all together, the code would look like this.

❓Design an SQL query that selects the title, description, and average rating of all movies with an average rating greater than 3. Additionally, the query should join the movies table with a reviews table, filtering only the movies that have more than 10 reviews. The review table has a foreign key, `movie_id`, that relates to the `id` field in the movies table, and each review entry has its own `rating` field (from 1 to 5). The result should be sorted in descending order of average ratings and, if two movies have the same average rating, sorted alphabetically by their titles.

💡Alright, I need to design an SQL query based on the user's requirements. Let me break down what they're asking for.First, the query should select the title, description, and average rating of movies. So, I'll need to use the AVG() function on the rating column from the reviews table.Next, the movies must have an average rating greater than 3. That means I'll include a WHERE clause with AVG(rating) > 3.The query also needs to join the movies table with the reviews table using the movie_id foreign key. I'll use a JOIN statement on movies.id = reviews.movie_id.Additionally, only movies with more than 10 reviews should be included. I'll add a HAVING clause with COUNT(reviews.id) > 10 after grouping the results.For sorting, the primary key is the average rating in descending order. If two movies have the same average, they should be sorted alphabetically by title. So, the ORDER BY clause will first sort by average rating DESC and then by title ASC.I should also make sure to alias the average rating as avg_rating for clarity in the result set.Putting it all together, I'll structure the query with a SELECT, JOIN, GROUP BY, HAVING, WHERE, and ORDER BY clauses. I'll test this structure to ensure it meets all the specified conditions.

❓Create a multidimensional list (a list of lists) containing unique elements. Write a function that searches for a given element in this multidimensional list and returns the path to the element in the form of a list, where each item in the returned list is the index at each level of the multidimensional list. For example:md_list = [[3, 4], [7, [8, 9]], [10,[11, 12, [13, 14]]]]element = 14The function should return [2, 1, 2, 1] because the element 14 is at the position list[2][1][2][1].

💡Okay, I need to write a function that searches for a given element in a multidimensional list and returns the path as a list of indices. Hmm, let's think about how to approach this.So, the example given is md_list = [[3,4], [7, [8,9]], [10, [11,12, [13,14]]]] and the element is 14. The function should return [2,1,2,1]. Let me see why. Because 14 is at md_list[2][1][2][1]. So, the function needs to traverse each level, checking each element, and when it finds the element, it records the indices at each step.I think this is a problem that can be solved with recursion. Because each level could contain another list, which in turn could contain more lists, and so on. So, for each element in the current list, if it's a list itself, we need to search within it, keeping track of the path.Let me outline the steps:1. The function will take the multidimensional list and the target element as inputs.2. It will iterate over each element in the list, keeping track of the index at each level.3. For each element, if it's a list, recursively search within it, appending the current index to the path.4. If the element is found, return the accumulated path.5. If the element is not found, continue searching until all possibilities are exhausted.Wait, but how do I handle the recursion? Let's think about the base case. If the current element is the target, return the current path. If it's a list, then for each index and sub-element in that list, recursively call the function with the updated path.Wait, but the function needs to return the path as soon as it finds the element. So, perhaps the function should return the path if found, else continue searching.Alternatively, maybe a helper function that takes the current list and the current path, and returns the path if found, else None.So, the main function could call this helper function starting with the initial list and an empty path.Let me sketch this out.Define a helper function, let's say find_path(current_list, current_path, target). It returns the path as a list, or None if not found.In this helper function:Loop over each element in current_list, along with their indices.For each element:- If the element is equal to target, return current_path + [index]- Else, if the element is a list, recursively call find_path on this element, with the updated path (current_path + [index])- If the recursive call returns a non-None value, that means the target was found, so return that path- If none of the elements in this level contain the target, return NoneWait, but in the example, the helper function would be called with the initial list and empty path. Let's see:Initial call: find_path(md_list, [], 14)It loops through each element in md_list:First element is [3,4], index 0. Since it's a list, call find_path([3,4], [0], 14). That function would check 3 (not 14) and 4 (not 14), so returns None.Second element is [7, [8,9]], index 1. Call find_path([7, [8,9]], [1], 14). 7 is not 14, then [8,9] is a list. Call find_path([8,9], [1,1], 14). 8 and 9 are not 14, returns None.Third element is [10, [11,12, [13,14]]], index 2. Call find_path([10, [11,12, [13,14]]], [2], 14). 10 is not 14, then the second element is [11,12, [13,14]], which is a list. So call find_path([11,12, [13,14]], [2,1], 14).In this call, the elements are 11, 12, and [13,14]. 11 and 12 are not 14. The third element is a list, so call find_path([13,14], [2,1,2], 14). Now, in this list, the first element is 13, not 14. The second element is 14, so return [2,1,2,1].So, the helper function correctly returns the path.So, the helper function seems to work.Now, how to implement this in Python.The main function can be something like:def find_element_path(md_list, element): def helper(current_list, path): for index, value in enumerate(current_list): if value == element: return path + [index] elif isinstance(value, list): result = helper(value, path + [index]) if result is not None: return result return None return helper(md_list, [])Wait, but what if the element is not found? The function returns None, which is acceptable. But in the example, it should return the correct path.Testing this function with the example:md_list = [[3,4], [7, [8,9]], [10, [11,12, [13,14]]]]element = 14The function should return [2,1,2,1].Let's see:helper is called with md_list and empty path.Loop over each element:First element is [3,4], index 0. It's a list, so call helper with [3,4] and [0].In that helper call, elements are 3 and 4. Neither is 14, so returns None.Back to the main helper, which continues to the next element.Second element is [7, [8,9]], index 1. Call helper with [7, [8,9]] and [1].In that helper, 7 is not 14. Next element is [8,9], index 1. Call helper with [8,9] and [1,1].In that helper, 8 and 9 are not 14, returns None.Back to previous helper, returns None.Main helper continues to next element.Third element is [10, [11,12, [13,14]]], index 2. Call helper with this list and [2].In this helper, 10 is not 14. Next element is [11,12, [13,14]], index 1. Call helper with this list and [2,1].In this helper, elements are 11, 12, [13,14].11 is not 14. 12 is not 14. Next element is [13,14], index 2. Call helper with [13,14] and [2,1,2].In this helper, 13 is not 14. Next element is 14, index 1. So return [2,1,2,1].So, the function correctly returns this path.What about other cases? For example, if the element is at the top level.md_list = [5, [6,7], 8]element = 5The function should return [0].Another test case: element is not present. Should return None.What about if the element is a list? Wait, the problem says the multidimensional list contains unique elements. So, the elements are unique, but the sublists are part of the structure. So, the function is looking for the element, which is a non-list, I suppose.Wait, the problem says "unique elements", but the elements can be lists. Wait, no, the elements are the items in the list. So, for example, in the initial example, 3,4,7,8,9, etc., are elements. So, the function is looking for a specific value, which is not a list.So, in the helper function, when checking 'value == element', it's correct.But what if someone passes a list as the element? Like, element = [8,9]. Then, the function would look for that exact list. But in the initial example, [8,9] is a sublist, so the function would find it and return the path to it.But according to the problem statement, the function should search for a given element, which could be any object. So, the function should handle that.So, the helper function as written should handle that.Another edge case: the element is the only element in the list.md_list = [14]element = 14The function should return [0].Another case: the element is in a deeply nested list.md_list = [ [ [ [14] ] ] ]element =14The function should return [0,0,0,0].Testing this with the helper function:helper is called with the outermost list and empty path.First element is [ [ [14] ] ], index 0. It's a list, so call helper with this and [0].In that helper, the element is [ [14] ], index 0. Call helper with [ [14] ] and [0,0].In that helper, the element is [14], index 0. Call helper with [14] and [0,0,0].In that helper, the element is 14, index 0. So return [0,0,0,0].Yes, correct.What about if the element is in multiple places? But the problem says the list contains unique elements, so that's not a case we need to handle.So, the function should work.Now, implementing this in Python.Wait, the helper function is inside the main function, which is correct.So, the code would be:def find_element_path(md_list, element): def helper(current_list, path): for index, value in enumerate(current_list): if value == element: return path + [index] elif isinstance(value, list): result = helper(value, path + [index]) if result is not None: return result return None return helper(md_list, [])Testing this with the example:md_list = [[3,4], [7, [8,9]], [10, [11,12, [13,14]]]]element = 14print(find_element_path(md_list, element)) # Should output [2,1,2,1]Yes.Another test case: element is 10.The path should be [2,0].Testing:helper is called with md_list and empty path.First element is [3,4], index 0. Not 10. Next element is [7, [8,9]], index 1. Not 10. Third element is [10, [11,12, [13,14]]], index 2. So, in the helper called with this list and [2], the first element is 10, which is the target. So returns [2,0].Yes.Another test case: element is 7.Path is [1,0].Yes.What about if the element is a string or another data type? The function should still work, as it's checking for equality.So, the function should handle all cases correctly.

❓Elevate the provided programming test question by adding intricate components.Finish the code given below, where you need to decode an input string which is encoded by a customized encoding method called encode_semantic_diff. This method shifts every character based on its Unicode difference with its next character. Besides, handle edge scenarios such as unique characters, empty spaces and special symbols. def encode_semantic_diff(s: str): """ Returns encoded string by shifting every character based on its Unicode difference with its next character. """ # Your code here def decode_semantic_diff(s: str): """ Accepts a string that is encoded with the above encode_semantic_diff function and returns the decoded string, capably handling unique characters, empty spaces, and special symbols. """ # Your code here

💡Okay, I need to solve this problem where I have to write a decode function for a string that was encoded using encode_semantic_diff. Hmm, let's think about how the encoding works first.So, the encode function shifts every character based on its Unicode difference with the next character. Wait, so for each character in the string, except the last one, it's shifted by the difference between the next character and itself. Or is it the other way around? Let me clarify.Wait, the description says it's the Unicode difference with its next character. So for each character, the shift is the difference between the next character and the current one. So, for example, if the current character is 'a' (Unicode 97) and the next is 'c' (99), the difference is 2. So the current character is shifted by 2. But wait, how is the shift applied? Is it added or subtracted?Wait, maybe the encode function works like this: for each character except the last, the current character is replaced by the difference between the next character and the current one. Or perhaps the current character is shifted by the difference. Oh, I'm getting a bit confused.Wait, let's think about the encode function. Suppose the original string is s. For each i from 0 to len(s)-2, the character s[i] is shifted by the difference between s[i+1] and s[i]. So the new character is s[i] + (s[i+1] - s[i])? Wait, that would make s[i] equal to s[i+1], which doesn't make sense. Or maybe it's the other way around.Alternatively, perhaps the encode function for each character (except the last) is replaced by the difference between the next character and the current one. So for example, if the string is 'abc', the first character 'a' is replaced by 'b' - 'a' = 1, and the second character 'b' is replaced by 'c' - 'b' = 1. The last character remains as is. So the encoded string would be something like 'x01x01c'.Wait, but that would mean the encoded string is a series of differences followed by the last character. So for the string 'abcd', the encoded string would be (b-a, c-b, d-c) followed by d. So the encoded string is three differences and the last character.Wait, but how is the encoded string represented? Because each difference is a number, but the encoded string is a string, so each difference is probably represented as a Unicode character. So for example, the difference of 1 would be the character with Unicode code point 1, which is SOH (start of heading), which is a non-printable character.But in the problem statement, the encode function is supposed to return a string. So perhaps the encode function takes each character, except the last, and replaces it with the difference between the next character and the current one. Then, the last character remains the same.Wait, but then the encoded string would have the same length as the original string. Because for each character except the last, it's replaced by the difference, and the last character remains. So the length is the same.Wait, that makes sense. So for example, the string 'abc' would have 'a' replaced by (b - a) = 1, 'b' replaced by (c - b) = 1, and 'c' remains as is. So the encoded string would be 'x01x01c'.So the encode function works by, for each character except the last, replacing it with the Unicode difference between the next character and itself. The last character remains the same.So, the encoded string is the same length as the original. Each character in the encoded string, except the last, represents the difference between the next character in the original string and the current one.Wait, no. Wait, the encode function is shifting every character based on its Unicode difference with the next character. So perhaps each character is shifted by the difference. So for example, the original character is s[i], and the next is s[i+1]. The shift is s[i+1] - s[i], so the new character is s[i] + (s[i+1] - s[i]) = s[i+1]. But that would make the current character equal to the next one, which doesn't make sense because then the entire string would collapse into the last character.Hmm, maybe I'm misunderstanding the encoding process. Let me think again.Wait, perhaps the encode function is such that each character is shifted by the difference between the next character and itself. So for each character except the last, the new character is s[i] + (s[i+1] - s[i]) = s[i+1]. But that would make the current character equal to the next, which would cause the entire string to be the same as the last character. That can't be right.Wait, maybe the shift is applied in the other direction. So the current character is shifted by the difference between itself and the next character. So the new character is s[i] + (s[i] - s[i+1]). That would be s[i] * 2 - s[i+1]. But that seems complicated.Alternatively, perhaps the encode function is such that each character (except the last) is replaced by the Unicode difference between the next character and the current one. So the encoded string is a sequence of these differences, followed by the last character.Wait, that makes more sense. So for example, the original string 'abc' would be encoded as follows:- The first character 'a' is replaced by (b - a) = 1.- The second character 'b' is replaced by (c - b) = 1.- The third character 'c' remains as is.So the encoded string is 'x01x01c'.In this case, the encoded string is the same length as the original. So for a string of length N, the encoded string has N-1 differences followed by the last character.Wait, no. Because in the example above, the original string is length 3, and the encoded string is also length 3: two differences and the last character.So, in the encode function, each character except the last is replaced by the difference between the next character and itself. The last character remains the same.So, for the string 'abcd', the encoded string would be:- a → b - a = 1 (0x01)- b → c - b = 1 (0x01)- c → d - c = 1 (0x01)- d remains as is.So the encoded string is 'x01x01x01d'.Now, the decode function needs to reverse this process. So given the encoded string, which is a series of differences followed by the last character of the original string, we need to reconstruct the original string.Wait, but in the encoded string, the first N-1 characters are the differences, and the last character is the last character of the original string.So, for the encoded string s, the last character is the last character of the original string. The previous characters are the differences.So, to decode, we can start from the end. Let's see:Let's denote the encoded string as s. Let the length be L.The last character of s is the last character of the original string, let's call it c_{n}.The second last character of s is the difference between c_{n} and c_{n-1}, so c_{n-1} = c_{n} - s[L-2].Wait, no. Because in the encoding, each character except the last is replaced by the difference between the next character and itself. So, for the original string, s[i] is replaced by s[i+1] - s[i]. So, in the encoded string, the i-th character (for i < L-1) is s[i+1] - s[i].Wait, no. Wait, in the encoded string, the first character is s[0] replaced by (s[1] - s[0]). The second character is s[1] replaced by (s[2] - s[1]), and so on. The last character is s[L-1], which is the same as the original.So, the encoded string is:encoded[0] = s[1] - s[0]encoded[1] = s[2] - s[1]...encoded[L-2] = s[L-1] - s[L-2]encoded[L-1] = s[L-1]So, to reconstruct the original string, we can start from the end.We know that s[L-1] = encoded[L-1].Then, s[L-2] = s[L-1] - encoded[L-2].s[L-3] = s[L-2] - encoded[L-3].And so on, until s[0] = s[1] - encoded[0].Wait, no. Because encoded[i] = s[i+1] - s[i]. So s[i] = s[i+1] - encoded[i].So, starting from the end, we can compute each previous character.So, the decoding process would be:1. The last character of the original string is the last character of the encoded string.2. For each i from L-2 down to 0: original[i] = original[i+1] - encoded[i]Wait, no. Because in the encoded string, encoded[i] is s[i+1] - s[i]. So s[i] = s[i+1] - encoded[i].Yes, that's correct.So, for example, let's take the encoded string 'x01x01c' which is the encoding of 'abc'.The encoded string has length 3.The last character is 'c' (99).Then, the second character in the encoded string is 1 (0x01). So the original string's second character is s[2] - encoded[1] = 99 - 1 = 98, which is 'b'.The first character in the encoded string is 1. So the original string's first character is s[1] - encoded[0] = 98 - 1 = 97, which is 'a'.So the original string is 'abc', which is correct.Another example: encoded string is 'x01x01x01d' (length 4). The last character is 'd' (100).Then, s[2] = 100 - 1 = 99 ('c').s[1] = 99 - 1 = 98 ('b').s[0] = 98 - 1 = 97 ('a').So the original string is 'abcd'.So the decoding process is:- The last character of the encoded string is the last character of the original.- For each previous character, it's equal to the next character minus the encoded value at that position.So, the steps for decoding are:1. Check if the string is empty. If so, return empty.2. The last character is the last character of the original.3. For i from len(s)-2 down to 0: original[i] = original[i+1] - encoded[i]But wait, the encoded string is the same as the original in length. So for each i in 0 to len(s)-2, encoded[i] is the difference between the next character and the current in the original.So, to get the original, we can start from the end and work backwards.So, in code, the decode function can be written as:def decode_semantic_diff(s: str): if not s: return "" n = len(s) # The last character is the same as in the original original = [0] * n original[-1] = s[-1] for i in range(n-2, -1, -1): diff = ord(s[i]) original[i] = chr(ord(original[i+1]) - diff) return ''.join(original)Wait, but wait: in the encoded string, each character (except the last) is the difference between the next character and the current in the original. So, in the encoded string, s[i] is the difference, which is s_original[i+1] - s_original[i].So, when decoding, for each i from n-2 down to 0:s_original[i] = s_original[i+1] - s_encoded[i]Yes.But wait, in the encoded string, each character is the difference, which is a Unicode code point. So, for example, if the difference is 1, the encoded character is 'x01'.So, in the code, for each i, we take the Unicode code point of s[i], which is the difference.So, the code above should work.But let's test it with the example.Encoded string is 'x01x01c' (length 3).n = 3.original[2] = 'c' (ord 99).i = 1:diff = ord(s[1]) = 1.original[1] = 99 - 1 = 98 → 'b'.i = 0:diff = ord(s[0]) = 1.original[0] = 98 - 1 = 97 → 'a'.So, the decoded string is 'abc'.Another test case: encoded string is 'abc' (but wait, that's the original string, not the encoded one. Let's think of another example.Wait, suppose the original string is 'xyz'.Then, the encoded string would be:x is replaced by y - x = 1 (since 'y' is 121, 'x' is 120 → 1).y is replaced by z - y = 1.z remains as is.So encoded string is 'x01x01z'.Decoding it:original[2] = 'z' (122).i=1: diff is 1 → original[1] = 122 -1 = 121 → 'y'.i=0: diff is 1 → original[0] = 121 -1 = 120 → 'x'.So decoded string is 'xyz' → correct.What about a string with a single character?Encoded string is the same as the original, since there's no next character.So, for example, original is 'a', encoded is 'a'.Decoding 'a' gives 'a' → correct.What about an empty string? The function returns empty.What about a string with two characters, like 'ab'?Encoded string is (b - a) followed by 'b'.So encoded string is 'x01b'.Decoding:original[1] = 'b' (98).i=0: diff is 1 → original[0] = 98 -1 = 97 → 'a'.So decoded string is 'ab' → correct.What about a string with a difference that's negative? For example, original string is 'cba'.So, 'c' is 99, 'b' is 98, 'a' is 97.Encoded string:c is replaced by b - c = 98-99 = -1 → but wait, Unicode code points are positive, so how is this handled?Wait, this is a problem. Because the difference can be negative, but the encoded string is a string, which can't have negative Unicode code points.So, how does the encode function handle negative differences?Wait, the problem statement says that the encode function shifts every character based on its Unicode difference with the next character. So, perhaps the shift is the difference, which could be positive or negative.But in the encoded string, each character is the difference, which is a Unicode code point. But Unicode code points are non-negative integers, so how can a negative difference be represented?This suggests that the encode function must have a way to represent negative differences. But in the current setup, the encoded string is a string, so each character is a Unicode code point, which is non-negative.This is a problem because the difference could be negative, which can't be directly represented as a Unicode character.Wait, perhaps the encode function is using the absolute value of the difference. Or perhaps it's using a two's complement or some other encoding to represent negative differences.But the problem statement doesn't specify this. So, perhaps the encode function is such that the difference is always non-negative. Or perhaps the problem assumes that the differences are non-negative, but that's not necessarily the case.Wait, but the problem says that the encode function shifts every character based on its Unicode difference with the next character. So, the shift is the difference, which could be positive or negative.This suggests that the encode function must have a way to represent negative differences, but since the encoded string is a string, each character is a Unicode code point, which is non-negative.This is a contradiction. So perhaps the encode function is not handling negative differences, but the problem statement doesn't specify. Or perhaps the encode function is using a different approach.Alternatively, perhaps the encode function is using the difference as an offset, but in a way that wraps around, but that's unclear.Wait, perhaps the encode function is using the difference as a signed value, but represented in some way in the string. For example, using a certain byte order or encoding.But without knowing how the encode function handles negative differences, it's impossible to write the decode function correctly.Wait, perhaps the problem assumes that the differences are non-negative. Or perhaps the problem is designed in such a way that the differences are always non-negative, but that's not necessarily the case.Hmm, this is a problem. Because if the encode function can produce negative differences, then the decode function needs to handle them, but the encoded string is a string, which can't have negative Unicode code points.So, perhaps the encode function is using a different approach. Maybe the shift is the absolute difference, but that's not clear.Alternatively, perhaps the encode function is using the difference as a signed value, but stored in a way that allows negative values. For example, using a certain encoding like UTF-8, which can represent negative code points, but that's not possible because Unicode code points are non-negative.Wait, perhaps the encode function is using the difference as a signed 8-bit integer, but that's not clear.Alternatively, perhaps the encode function is using a different approach, such as storing the difference as a separate value, but that's not possible because the encoded string is a string.This is a problem because without knowing how the encode function handles negative differences, the decode function can't be correctly implemented.Wait, perhaps the problem assumes that the differences are non-negative. So, the original string is such that each character is less than or equal to the next character. But that's a big assumption.Alternatively, perhaps the encode function is using the difference as a signed value, but stored as a Unicode code point in a way that allows negative values. But that's not possible because Unicode code points are non-negative.Wait, perhaps the encode function is using a different approach. Maybe the difference is added to the current character, but that's not clear.Alternatively, perhaps the encode function is using the difference as a Unicode code point, but the difference is taken modulo 256 or something like that, but that's not clear.This is a problem because the decode function can't handle negative differences if the encode function doesn't have a way to represent them.But perhaps the problem is designed in such a way that the differences are always non-negative. Or perhaps the problem expects us to handle negative differences by using the two's complement or some other method.Alternatively, perhaps the encode function is using the difference as a signed byte, but that's not possible in a Unicode string.Wait, perhaps the problem is designed in such a way that the differences are always non-negative, so the decode function can proceed as before.But that's a big assumption. So, perhaps the problem expects us to handle negative differences by using the two's complement or some other method.Alternatively, perhaps the encode function is using the difference as a Unicode code point, but the difference is stored as a signed value using a certain encoding, like UTF-8, which can represent negative numbers as part of multi-byte sequences.But that's getting complicated, and the problem statement doesn't specify this.Hmm, perhaps the problem is designed in such a way that the differences are always non-negative, so the decode function can proceed as before.But to be safe, perhaps the problem expects us to handle negative differences by using the two's complement representation, but that's unclear.Alternatively, perhaps the problem is designed in such a way that the differences are non-negative, and the decode function can proceed as before.So, perhaps the problem expects us to proceed under the assumption that the differences are non-negative, and thus the decode function can be implemented as I wrote earlier.But to handle all cases, perhaps the encode function is using a different approach, such as storing the difference as a signed value in a way that can be represented as a Unicode code point.Wait, perhaps the encode function is using the difference as a signed 16-bit or 32-bit integer, but that's not possible in a string.Alternatively, perhaps the encode function is using the difference as a Unicode code point, but the difference is stored as a signed value using a certain encoding, like UTF-16, but that's not clear.This is a problem because without knowing how the encode function handles negative differences, the decode function can't be correctly implemented.But perhaps the problem is designed in such a way that the differences are non-negative, so the decode function can proceed as before.So, perhaps the problem expects us to proceed under that assumption.So, the code I wrote earlier should handle the cases where the differences are non-negative.But what about when the difference is negative?For example, original string is 'cba'.So, s[0] = 'c' (99), s[1] = 'b' (98), s[2] = 'a' (97).Encoded string:s_encoded[0] = s[1] - s[0] = 98 -99 = -1.s_encoded[1] = s[2] - s[1] = 97-98 = -1.s_encoded[2] = s[2] = 'a'.So, the encoded string would be two characters with Unicode code points -1, which is impossible because Unicode code points are non-negative.So, this suggests that the encode function can't handle such cases, which implies that the original string must be such that each character is less than or equal to the next character.But that's a big assumption, and the problem statement doesn't specify this.So, perhaps the problem expects us to handle this case, but I'm not sure how.Alternatively, perhaps the encode function is using the absolute value of the difference. So, the difference is always non-negative.In that case, the decode function would have to handle both possibilities, but that's not clear.Alternatively, perhaps the encode function is using the difference as a signed value, but stored in a way that allows negative differences, perhaps by using a certain encoding like UTF-8, which can represent negative values as part of multi-byte sequences.But that's getting complicated, and the problem statement doesn't specify this.Hmm, perhaps the problem is designed in such a way that the differences are non-negative, so the decode function can proceed as before.So, I'll proceed under that assumption.Thus, the decode function can be implemented as:def decode_semantic_diff(s: str): if not s: return "" n = len(s) original = [0] * n original[-1] = s[-1] for i in range(n-2, -1, -1): diff = ord(s[i]) original[i] = chr(ord(original[i+1]) - diff) return ''.join(original)But wait, let's test this with the 'cba' example, which would have negative differences.But in that case, the encoded string would have negative Unicode code points, which is impossible. So, perhaps the problem expects us to handle such cases by using a different approach.Alternatively, perhaps the encode function is using the difference as a signed value, but stored as a Unicode code point in a way that allows negative values, perhaps by using a certain encoding.But without knowing this, it's impossible to proceed.Alternatively, perhaps the problem expects us to handle negative differences by using the two's complement representation, but that's unclear.Alternatively, perhaps the problem expects us to handle negative differences by using a certain offset, like adding 256 to make it positive.But that's not specified.Hmm, perhaps the problem is designed in such a way that the differences are non-negative, so the decode function can proceed as before.Thus, the code I wrote earlier should work.But let's think about another test case.Suppose the original string is 'bac' (b, a, c).So, s[0] = 'b' (98), s[1] = 'a' (97), s[2] = 'c' (99).Encoded string:s_encoded[0] = s[1] - s[0] = 97-98 = -1 → but this is negative, which can't be represented as a Unicode code point.So, the encode function would have to find a way to represent this, but without knowing how, the decode function can't handle it.Thus, perhaps the problem expects us to assume that the differences are non-negative, and thus the original string is such that each character is less than or equal to the next.In that case, the decode function can proceed as before.So, the code I wrote earlier should work.But perhaps the problem expects us to handle negative differences, but I'm not sure how.Alternatively, perhaps the encode function is using the difference as a signed value, but stored as a Unicode code point in a way that allows negative values, perhaps by using a certain encoding like UTF-8, which can represent negative values as part of multi-byte sequences.But that's getting complicated, and the problem statement doesn't specify this.Thus, perhaps the problem expects us to proceed under the assumption that the differences are non-negative.So, the code I wrote earlier should be correct.Another test case: original string is 'ab'.Encoded string is 'x01b'.Decoding:original[1] = 'b' (98).i=0: diff is 1 → original[0] = 98-1=97 → 'a'.So, decoded string is 'ab' → correct.Another test case: original string is 'a'.Encoded string is 'a'.Decoding returns 'a' → correct.Another test case: original string is 'abcde'.Encoded string is:a → b - a = 1 → 'x01'b → c - b = 1 → 'x01'c → d - c = 1 → 'x01'd → e - d = 1 → 'x01'e remains as is.So, encoded string is 'x01x01x01x01e'.Decoding:original[4] = 'e' (101).i=3: diff=1 → original[3] = 101-1=100 → 'd'.i=2: diff=1 → 100-1=99 → 'c'.i=1: diff=1 → 99-1=98 → 'b'.i=0: diff=1 → 98-1=97 → 'a'.So, decoded string is 'abcde' → correct.Thus, the code seems to handle these cases correctly.But what about when the difference is zero?For example, original string is 'aab'.Encoded string:a → b - a = 1 → 'x01'a → b - a = 1 → 'x01'b remains as is.So, encoded string is 'x01x01b'.Decoding:original[2] = 'b' (98).i=1: diff=1 → 98-1=97 → 'a'.i=0: diff=1 → 97-1=96 → which is '`' (backtick), not 'a'.Wait, that's a problem.Wait, original string is 'aab' → 'a', 'a', 'b'.Encoded string:s_encoded[0] = 'a' + (a - a) = 0 → 'x00'.s_encoded[1] = 'a' + (b - a) = 1 → 'x01'.s_encoded[2] = 'b'.Wait, no. Wait, the encode function replaces each character except the last with the difference between the next and current.So, for 'aab':s_encoded[0] = 'a' → 'a' - 'a' = 0 → 'x00'.s_encoded[1] = 'a' → 'b' - 'a' = 1 → 'x01'.s_encoded[2] = 'b'.So, the encoded string is 'x00x01b'.Decoding:original[2] = 'b' (98).i=1: diff=1 → 98-1=97 → 'a'.i=0: diff=0 → 97-0=97 → 'a'.So, decoded string is 'aab' → correct.Wait, but in my earlier example, I thought the original string was 'aab', but in that case, the encoded string would have s_encoded[0] = 0, s_encoded[1] = 1, and s_encoded[2] = 'b'.So, the decoding process correctly reconstructs the original string.Thus, the code seems to handle this case correctly.Another test case: original string is 'abba'.Encoded string:a → b - a = 1 → 'x01'.b → b - b = 0 → 'x00'.b → a - b = -1 → but this is negative, which can't be represented as a Unicode code point.So, this suggests that the encode function can't handle this case, which implies that the original string must be such that each character is less than or equal to the next.But that's a big assumption.Thus, perhaps the problem expects us to proceed under the assumption that the differences are non-negative.Thus, the code I wrote earlier should work.So, the final code for the decode function is as written.

❓Design a software program that takes an input array of n integers and individually checks whether each number is a Fibonacci number. The program should use complex number theories for this calculation. In addition to identifying Fibonacci numbers, for every Fibonacci number found, the program should also find the position of the number in the Fibonacci sequence. Your program should return a list of tuples where each tuple is of the format:(number, "yes", position) if the number is a Fibonacci number and its position in the Fibonacci sequence.(number, "no", -1) if the number isn't a Fibonacci number. Consider optimizing your solution to handle a large list of numbers efficiently. The Fibonacci sequence is defined as: F(0) = 0, F(1) = 1, F(n) = F(n-1) + F(n-2) for n > 1. For example: If the input is [5, 8, 10], your program should output: [(5, "yes", 5), (8, "yes", 6), (10, "no", -1)]. This is because 5 and 8 are Fibonacci numbers and their position in the Fibonacci sequence is 5 and 6 respectively, whereas 10 is not a Fibonacci number.

💡Okay, so I need to design a software program that checks each number in an input array to see if it's a Fibonacci number. For each number, if it is a Fibonacci number, I have to find its position in the sequence. Otherwise, I return "no" and -1. The output should be a list of tuples with the number, a yes/no string, and the position or -1.Hmm, the user mentioned using complex number theories for this calculation. I'm not too familiar with that, but I know that Fibonacci numbers have some interesting mathematical properties. Maybe there's a formula or theorem that can help determine if a number is Fibonacci without generating the entire sequence up to that number, which would be inefficient for large numbers.Wait, I remember something about a test using the golden ratio. The idea is that a number is Fibonacci if and only if 5n^2 + 4 or 5n^2 -4 is a perfect square. That sounds promising. So for a given number x, I can compute 5x² +4 and 5x² -4 and check if either is a perfect square. If yes, then x is a Fibonacci number.But how do I check if a number is a perfect square efficiently? I can compute the square root, round it to the nearest integer, and then square it to see if it equals the original number. That should work.Once I determine that x is a Fibonacci number, I need to find its position. The Fibonacci sequence starts with F(0)=0, F(1)=1, F(2)=1, F(3)=2, and so on. So for example, 5 is F(5), which is 5, so the position is 5.But how do I find the position without generating the entire sequence? Maybe I can use the inverse of the closed-form formula for Fibonacci numbers. The closed-form formula is Binet's formula, which uses the golden ratio. The nth Fibonacci number is approximately (phi^n - psi^n)/sqrt(5), where phi is (1+sqrt(5))/2 and psi is (1-sqrt(5))/2. Since psi is less than 1 in absolute value, for large n, the psi term becomes negligible. So F(n) ≈ phi^n / sqrt(5). So, taking the logarithm, we can approximate n as log_phi(F(n) * sqrt(5)). But since this is an approximation, I might need to check nearby integers to find the exact position.Alternatively, I can precompute a list of Fibonacci numbers up to a certain limit and then look up the position. But if the input array has very large numbers, precomputing up to that limit might not be feasible or efficient.Wait, but the user mentioned optimizing for large lists. So for each number in the input, I need an efficient way to check if it's Fibonacci and find its position without generating the entire sequence each time.So maybe the approach is:1. For each number x in the input array: a. Check if x is a Fibonacci number using the 5x² ±4 test. b. If it is, find its position using the inverse of Binet's formula, then verify by checking the Fibonacci number at that position.But how accurate is the inverse formula? Because it's an approximation, I might get a position that's off by one or two. So after computing the approximate position, I can compute the Fibonacci number at that position and see if it matches x. If not, check the next or previous positions.Alternatively, I can generate Fibonacci numbers until I reach or exceed x, and keep track of the position. But for very large x, this could be slow. So I need a balance between the two methods.Wait, but if I use the 5x² ±4 test, I can quickly determine if x is Fibonacci. Then, to find the position, I can use the inverse formula to get an approximate position, then compute the Fibonacci number at that position and check. If it's not equal, adjust the position accordingly.Let me outline the steps:For each x in the input array:1. If x is negative, it's not a Fibonacci number since the sequence starts at 0 and increases.2. If x is 0, it's F(0), position 0.3. If x is 1, it's F(1) and F(2), so position 1 or 2. Wait, but in the example given, 5 is F(5), which is 5. So the positions are 0-based? Wait, in the example, 5 is at position 5, which is correct because F(5)=5. So the positions are 0-based.Wait, let me check:F(0)=0F(1)=1F(2)=1F(3)=2F(4)=3F(5)=5Yes, so 5 is at position 5.So for x=1, it's at position 1 and 2. But since each Fibonacci number is unique in its position, except for F(1) and F(2) both being 1. So for x=1, which position do we return? The problem statement says "the position", but in the example, 5 is at position 5, which is correct. So for x=1, perhaps we return the smallest position, which is 1.But I need to clarify. Let me see the example: the input [5,8,10] gives (5, "yes",5), (8, "yes",6), (10, "no",-1). So 5 is F(5), 8 is F(6). So for x=1, it's F(1) and F(2). So which position to return? Maybe the first occurrence, which is position 1.So, back to the algorithm.For each x:- If x is 0: return (0, "yes", 0)- If x is 1: return (1, "yes", 1)- Else, check if 5x² +4 or 5x² -4 is a perfect square. - Compute a = 5x² +4, b=5x² -4 - Check if a is a perfect square or b is a perfect square. - If neither, return (x, "no", -1) - Else, proceed to find the position.To find the position:Use the inverse of Binet's formula.Compute n ≈ log_phi(x * sqrt(5)).But since Binet's formula is F(n) = (phi^n - psi^n)/sqrt(5), and for n >=0, psi^n is very small, so F(n) ≈ phi^n / sqrt(5). So solving for n:n ≈ log_phi(F(n) * sqrt(5)).So n ≈ log(F(n) * sqrt(5)) / log(phi).But since F(n) is x, n ≈ log(x * sqrt(5)) / log(phi).Compute this n, round it to the nearest integer, and then check F(n) to see if it equals x. If not, check n-1 or n+1.But how to compute F(n) efficiently? I can use a fast doubling method to compute F(n) in O(log n) time, which is efficient.So the steps are:For x:1. Check if x is 0 or 1, handle those cases.2. Else, compute 5x² ±4 and check for perfect squares.3. If not a Fibonacci number, return (x, "no", -1)4. Else, compute approximate n using the formula.5. Compute F(n) using fast doubling.6. If F(n) == x, return n as the position.7. Else, check n-1 and n+1, whichever gives x.Wait, but sometimes the approximate n might be off by more than 1? Probably not, because the approximation is quite accurate for larger n.Alternatively, since the Fibonacci sequence is strictly increasing for n >=0, once I have an approximate n, I can compute F(n) and see if it's equal to x. If it's larger, then n is too big, so check n-1. If it's smaller, check n+1.But wait, since the approximation is based on F(n) ≈ phi^n / sqrt(5), which is an upper bound for F(n), because the exact formula subtracts a small term. So F(n) is less than phi^n / sqrt(5). So the approximate n might be a bit higher than the actual position.So, for example, if x is F(k), then the approximate n might be slightly larger than k. So when I compute F(n), it might be larger than x, so I need to check n-1.Alternatively, perhaps the approximate n is very close, so checking n, n-1, and n+1 would cover all possibilities.But to be precise, perhaps it's better to compute the exact position by generating Fibonacci numbers until I reach x. But for very large x, this could be slow.Wait, but the fast doubling method allows us to compute F(n) quickly, so maybe we can use binary search to find the correct n.Alternatively, since the approximate n is close, we can compute F(n) and adjust accordingly.Let me think about the steps in code.First, implement a function to check if a number is a perfect square.def is_perfect_square(n): if n < 0: return False s = int(math.sqrt(n)) return s * s == nThen, for each x:if x == 0: return (0, "yes", 0)elif x == 1: return (1, "yes", 1)else: a = 5 * x * x + 4 b = 5 * x * x - 4 if not (is_perfect_square(a) or is_perfect_square(b)): return (x, "no", -1) else: # compute approximate n sqrt5 = math.sqrt(5) phi = (1 + sqrt5) / 2 n = math.log(x * sqrt5) / math.log(phi) n_rounded = round(n) # compute F(n_rounded) and see # implement fast doubling to compute F(n) # if F(n_rounded) == x, return n_rounded # else, check n_rounded -1 and n_rounded +1 # but need to handle cases where n_rounded is off by more than 1 # perhaps compute F(n_rounded -1), F(n_rounded), F(n_rounded +1) # and see which one equals x # but this could be time-consuming # alternatively, use binary search between 0 and n_rounded +1Wait, maybe a better approach is to find the position using the inverse formula and then verify by computing F(n) using fast doubling.So, let's implement the fast doubling method.The fast doubling method allows us to compute F(n) and F(n+1) efficiently using the following identities:If n is even:F(2k) = F(k) * [2*F(k+1) - F(k)]F(2k+1) = F(k+1)^2 + F(k)^2If n is odd:F(2k+1) = F(k+1)^2 + F(k)^2F(2k+2) = F(k+1)*(2*F(k) + F(k+1))This allows us to compute F(n) in O(log n) time.So, I'll implement a function that, given n, returns F(n) using fast doubling.Once I have that, for a given x, I can compute the approximate n, then compute F(n), F(n-1), F(n+1), etc., until I find the correct position.But perhaps a better way is to compute the approximate n, then use binary search between 0 and n_approx + some buffer to find the exact position where F(k) == x.Wait, but binary search would require knowing an upper bound. Since the Fibonacci sequence grows exponentially, the upper bound can be set as n_approx + 2, because the approximation is usually very close.Alternatively, since the approximation is close, I can compute F(n_approx), F(n_approx -1), F(n_approx +1), etc., and see which one matches x.So, let's outline the code steps:For each x in the input array:1. Handle x=0 and x=1 as special cases.2. Else, compute a =5x² +4 and b=5x² -4. Check if either is a perfect square.3. If not, return (x, "no", -1)4. Else, compute n_approx = log(x * sqrt(5)) / log(phi)5. Round n_approx to the nearest integer, n_rounded.6. Compute F(n_rounded) using fast doubling.7. If F(n_rounded) == x, return (x, "yes", n_rounded)8. Else, compute F(n_rounded -1) and F(n_rounded +1)9. If F(n_rounded -1) ==x, return n_rounded -110. Else if F(n_rounded +1) ==x, return n_rounded +111. Else, perhaps the approximation is off by more, so we need a better method.Wait, but this might not cover all cases. For example, if x is a Fibonacci number but the approximation is off by more than 1, then this method would fail.Alternatively, perhaps the approximation is always within 1 of the actual position, so checking n_rounded, n_rounded -1, and n_rounded +1 is sufficient.But I'm not sure. Maybe I should test this with some examples.Take x=5:Compute n_approx:x=5sqrt5 = ~2.236phi = (1 + sqrt5)/2 ≈ 1.618x*sqrt5 ≈5*2.236≈11.18log(11.18)/log(1.618) ≈ ln(11.18)/ln(1.618) ≈ 2.415 / 0.481 ≈4.999, which rounds to 5. So n_rounded=5.Compute F(5)=5, which matches x. So correct.Another example: x=8.x=8x*sqrt5≈8*2.236≈17.888log(17.888)/log(1.618) ≈2.884 /0.481≈6.0, so n_rounded=6.F(6)=8, correct.Another example: x=13.x=13x*sqrt5≈13*2.236≈29.068log(29.068)/log(1.618)≈3.37 /0.481≈6.999, rounds to 7.F(7)=13, correct.Another example: x=21.x=21x*sqrt5≈21*2.236≈46.956log(46.956)/log(1.618)≈3.85 /0.481≈7.999, rounds to 8.F(8)=21, correct.What about x=3?x=3x*sqrt5≈3*2.236≈6.708log(6.708)/log(1.618)≈1.899 /0.481≈3.945, rounds to 4.F(4)=3, correct.Another test: x=2.x=2x*sqrt5≈4.472log(4.472)/log(1.618)≈1.498 /0.481≈3.114, rounds to 3.F(3)=2, correct.What about x=144, which is F(12)=144.x=144x*sqrt5≈144*2.236≈322.944log(322.944)/log(1.618)≈5.776 /0.481≈12.008, rounds to 12.F(12)=144, correct.So far, the approximation seems accurate. So perhaps checking n_rounded, n_rounded -1, and n_rounded +1 is sufficient.But what about x=1?x=1x*sqrt5≈2.236log(2.236)/log(1.618)≈0.804 /0.481≈1.67, rounds to 2.But F(2)=1, which is correct. So the position is 2, but earlier I thought for x=1, the position is 1. Wait, but according to the problem statement, in the example, 5 is at position 5, which is correct. So for x=1, it's at position 1 and 2. But the problem says to return the position, so which one to choose?Looking back at the problem statement: the example input [5,8,10] gives (5, "yes",5), (8, "yes",6), (10, "no",-1). So for x=5, it's position 5, which is correct.So for x=1, the positions are 1 and 2. But the problem says to return the position. So perhaps the first occurrence, which is position 1.Wait, but in the Fibonacci sequence, F(1)=1 and F(2)=1. So both positions are valid. But the problem says "the position", implying a single position. So perhaps we should return the smallest position, which is 1.But in our code, when x=1, the approximation n_approx is about 1.67, which rounds to 2. So F(2)=1, which is correct, but the position is 2. However, the correct position is 1 as well.So perhaps in the code, after finding that F(n_rounded) is x, we should also check if F(n_rounded -1) is x, and if so, return the smaller position.Alternatively, perhaps the code should return the smallest position where F(k)=x.So, in the case of x=1, the code would compute n_approx=1.67, rounds to 2, then compute F(2)=1, which is correct. But F(1)=1 as well. So the code would return position 2, but the correct minimal position is 1.So this is a problem. How to handle this?Wait, perhaps the 5x² ±4 test will not fail for x=1, but the position needs to be correctly identified.So, perhaps after determining that x is a Fibonacci number, we need to find the minimal k such that F(k)=x.But how?Alternatively, perhaps the code should generate Fibonacci numbers until it finds x, and record the position. But for very large x, this could be slow.Wait, but for x=1, the code using the approximation would return position 2, but the correct minimal position is 1. So this is an issue.So perhaps the code needs to handle x=1 as a special case.Alternatively, perhaps the code should compute both F(n_rounded) and F(n_rounded -1) and see which one matches x, and return the smaller position.But for x=1, n_rounded is 2, F(2)=1, and F(1)=1. So in this case, the code would find that F(2)=1 and F(1)=1, so the minimal position is 1.So perhaps the code should, after finding that F(n_rounded)=x, also check F(n_rounded -1) and F(n_rounded -2), etc., until it finds the minimal k where F(k)=x.But that could be time-consuming for large x.Alternatively, perhaps the code can compute the position using the inverse formula, then check F(k) for k = floor(n_approx), floor(n_approx)-1, etc., until it finds the correct position.But this might not be efficient.Alternatively, perhaps the code can compute the position as the floor of n_approx, and then check F(k) for k = floor(n_approx), floor(n_approx)-1, etc., until it finds x.But for x=1, floor(n_approx)=1, so F(1)=1, which is correct.Wait, let's recalculate n_approx for x=1.x=1x*sqrt5≈2.236log(2.236)/log(1.618)≈0.804 /0.481≈1.67, so floor(n_approx)=1.So compute F(1)=1, which matches x=1. So the position is 1.Another example: x=2.n_approx≈3.114, floor is 3.F(3)=2, correct.x=3.n_approx≈3.945, floor is 3.F(3)=2, which is less than 3. So compute F(4)=3, which matches. So the position is 4.Wait, but earlier when x=3, the code using n_rounded=4 would have found F(4)=3, which is correct.Wait, but in this case, the floor is 3, F(3)=2, which is less than x=3, so we need to check the next position.So perhaps the code should compute k = floor(n_approx), and then check F(k), F(k+1), etc., until it finds x.But that could be time-consuming for large x.Alternatively, perhaps the code can compute k = round(n_approx), then check F(k), F(k-1), F(k+1), etc., until it finds x.But for x=1, this would work because F(2)=1, but the minimal position is 1.So perhaps the code should, after finding that F(k)=x, check if F(k-1)=x, and if so, return k-1, and so on, until it finds the minimal k.But this could be done by decrementing k until F(k) is less than x, and then check the previous k.Wait, but Fibonacci numbers are strictly increasing for k >=0, except for F(1)=F(2)=1.So for k >=2, F(k) is strictly increasing.So for x >=1, except x=1, the position is unique.But for x=1, there are two positions: 1 and 2.So perhaps in the code, after finding that x is a Fibonacci number, we can compute the minimal k where F(k)=x.But how?Alternatively, perhaps the code can compute k as the floor of n_approx, and then check F(k), F(k+1), etc., until it finds x.But for x=1, floor(n_approx)=1, F(1)=1, which is correct.For x=2, floor(n_approx)=3, F(3)=2, correct.For x=3, floor(n_approx)=3, F(3)=2 <3, so check F(4)=3, correct.For x=5, floor(n_approx)=4.999≈5, F(5)=5, correct.So perhaps the code can compute k = floor(n_approx), and then check F(k), F(k+1), etc., until it finds x.But for x=1, this would find F(1)=1, which is correct.But for x=1, the code would return position 1, which is correct.Wait, but earlier when x=1, the approximation was 1.67, so floor is 1, F(1)=1, correct.So perhaps the code can proceed as follows:Compute k = floor(n_approx)While F(k) < x: k +=1If F(k) ==x, return kElse, return not found.But wait, for x=1, k=1, F(1)=1, so return 1.For x=2, k=3, F(3)=2, return 3.For x=3, k=3, F(3)=2 <3, so k=4, F(4)=3, return 4.For x=5, k=4, F(4)=3 <5, k=5, F(5)=5, return 5.This seems to work.But what about x=144, which is F(12)=144.n_approx≈12.008, floor is 12.F(12)=144, correct.Another example: x=21, n_approx≈7.999, floor is7.F(7)=13 <21, so k=8, F(8)=21, correct.So this approach seems to work.So the steps are:For x:1. Handle x=0: return (0, "yes",0)2. Else, compute a=5x² +4 and b=5x² -4. Check if either is a perfect square.3. If not, return (x, "no",-1)4. Else, compute n_approx = log(x * sqrt5)/log(phi)5. k = floor(n_approx)6. While F(k) <x: k +=17. If F(k) ==x, return (x, "yes",k)8. Else, return (x, "no",-1)But wait, step 8 would never be reached because we already know x is a Fibonacci number from step 2.So step 8 is redundant.But in code, after step 6, F(k) must be equal to x because x is a Fibonacci number.So the code can proceed as:Compute k = floor(n_approx)While F(k) <x: k +=1Return k as the position.But how to compute F(k) efficiently? Using the fast doubling method.So, the code outline is:import mathdef is_perfect_square(n): if n < 0: return False s = int(math.isqrt(n)) # Using integer square root for accuracy return s * s == ndef fast_doubling(n): # Returns F(n) def fib_pair(n): if n == 0: return (0, 1) a, b = fib_pair(n >> 1) c = a * (2 * b - a) d = a * a + b * b if n & 1: return (d, c + d) else: return (c, d) return fib_pair(n)[0]def find_fib_position(x): if x == 0: return 0 elif x == 1: return 1 else: a = 5 * x * x + 4 b = 5 * x * x - 4 if not (is_perfect_square(a) or is_perfect_square(b)): return -1 else: sqrt5 = math.sqrt(5) phi = (1 + sqrt5) / 2 n_approx = math.log(x * sqrt5) / math.log(phi) k = math.floor(n_approx) while True: fk = fast_doubling(k) if fk == x: return k elif fk < x: k +=1 else: # This should not happen since x is Fibonacci return -1But wait, for x=1, the code returns 1, which is correct.Another test: x=2.n_approx≈3.114, floor is3.F(3)=2, correct.x=3:n_approx≈3.945, floor is3.F(3)=2 <3, so k=4.F(4)=3, correct.x=8:n_approx≈6.0, floor is6.F(6)=8, correct.x=144:n_approx≈12.008, floor is12.F(12)=144, correct.x=1:n_approx≈1.67, floor is1.F(1)=1, correct.So this seems to handle all cases correctly.Now, putting it all together, the program will process each number in the input array, apply the above logic, and return the list of tuples.But wait, for x=0, the code returns 0, which is correct.Another test case: input [5,8,10].For 5:a=5*25+4=129, which is not a perfect square. b=5*25-4=121, which is 11². So yes.n_approx≈4.999, floor is4.F(4)=3 <5, so k=5.F(5)=5, correct.For 8:a=5*64+4=324=18², so yes.n_approx≈6.0, floor is6.F(6)=8, correct.For 10:a=5*100+4=504, not a square. b=5*100-4=496, not a square. So no.So the output is [(5, "yes",5), (8, "yes",6), (10, "no",-1)], which matches the example.Another test case: x=1.The code returns (1, "yes",1).Another test case: x=2.The code returns (2, "yes",3).Wait, but F(3)=2, which is correct.Another test case: x=13.n_approx≈6.999, floor is6.F(6)=8 <13, so k=7.F(7)=13, correct.So the code seems to handle all cases correctly.Now, considering performance. For each x, the code does:- O(1) operations for the perfect square check.- O(1) operations for computing n_approx.- Then, in the worst case, it may have to compute F(k) multiple times until it finds x.But since the Fibonacci sequence grows exponentially, the number of steps in the while loop is logarithmic in x.Moreover, the fast doubling method computes F(k) in O(log k) time.So overall, for each x, the time complexity is O(log x), which is efficient even for large x.Thus, the program should handle large input arrays efficiently.Now, let's write the code.But wait, in the code, the function find_fib_position(x) returns the position or -1. So in the main function, for each x, we can call this function.But in the code, the function is_perfect_square uses math.isqrt, which is available in Python 3.8 and above. It returns the integer square root, which is accurate.So, putting it all together:Implement the functions as described, then for each x in the input array, process it and collect the results.Now, the code:import mathdef is_perfect_square(n): if n < 0: return False s = math.isqrt(n) return s * s == ndef fast_doubling(n): def fib_pair(n): if n == 0: return (0, 1) a, b = fib_pair(n >> 1) c = a * (2 * b - a) d = a * a + b * b if n & 1: return (d, c + d) else: return (c, d) return fib_pair(n)[0]def find_fib_position(x): if x == 0: return 0 elif x == 1: return 1 else: a = 5 * x * x + 4 b = 5 * x * x - 4 if not (is_perfect_square(a) or is_perfect_square(b)): return -1 else: sqrt5 = math.sqrt(5) phi = (1 + sqrt5) / 2 n_approx = math.log(x * sqrt5) / math.log(phi) k = math.floor(n_approx) while True: fk = fast_doubling(k) if fk == x: return k elif fk < x: k += 1 else: return -1def process_input(arr): result = [] for x in arr: if x < 0: result.append((x, "no", -1)) continue if x == 0: result.append((0, "yes", 0)) continue pos = find_fib_position(x) if pos != -1: result.append((x, "yes", pos)) else: result.append((x, "no", -1)) return result# Example usage:input_array = [5, 8, 10]output = process_input(input_array)print(output) # Should print [(5, 'yes', 5), (8, 'yes', 6), (10, 'no', -1)]Another test case:input_array = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]output = process_input(input_array)print(output)Expected output:[(0, 'yes', 0), (1, 'yes', 1), (2, 'yes', 3), (3, 'yes', 4), (4, 'no', -1), (5, 'yes', 5), (6, 'no', -1), (7, 'no', -1), (8, 'yes', 6), (9, 'no', -1), (10, 'no', -1)]Wait, let's check:F(0)=0F(1)=1F(2)=1F(3)=2F(4)=3F(5)=5F(6)=8So for x=2, position is 3.x=3, position 4.x=4 is not Fibonacci.x=5, position5.x=6 is not.x=7 is not.x=8, position6.x=9 is not.x=10 is not.So the output is as expected.Another test case: x=144.process_input([144]) should return [(144, 'yes', 12)].Yes.Another test case: x=1.process_input([1]) returns [(1, 'yes', 1)].Yes.Another test case: x=2.process_input([2]) returns [(2, 'yes', 3)].Yes.So the code seems to handle all cases correctly.

❓Use JavaScript to calculate the hypotenuse of a right-angled triangle given the lengths of its other two sides.a = 5;b = 3;

💡Okay, so I need to calculate the hypotenuse of a right-angled triangle using JavaScript. The sides given are a = 5 and b = 3. Hmm, right-angled triangle, so I remember from math class that the hypotenuse is the longest side opposite the right angle. Wait, how do you find the hypotenuse again? Oh right, it's using the Pythagorean theorem. That's where the square of the hypotenuse (let's call it c) is equal to the sum of the squares of the other two sides. So the formula is c = sqrt(a² + b²). Alright, so in JavaScript, I need to compute this. Let me think about how to structure this. I'll probably assign the values to variables a and b first. Then, calculate a squared and b squared, add them together, and take the square root of that sum.Wait, how do I square a number in JavaScript? Oh, right, you can use the exponentiation operator **. So a squared would be a ** 2. Alternatively, I could multiply the number by itself, like a * a, but ** is more concise.So putting it together, I'll write something like:let a = 5;let b = 3;let c = Math.sqrt(a**2 + b**2);Then, I should probably log the result to the console to see it. So console.log(c); would display the value.Wait, let me test this in my head. If a is 5 and b is 3, then a squared is 25 and b squared is 9. Adding them gives 34. The square root of 34 is approximately 5.83095. So when I run this code, it should output that number.Is there another way to write this? Maybe using Math.pow instead of **. So a squared could be Math.pow(a, 2). But ** is more modern and readable, I think.Also, should I consider any edge cases? Like if a or b is zero, but in this problem, they're given as 5 and 3, so it's straightforward.I think that's all. So the code should correctly calculate the hypotenuse using the Pythagorean theorem.

Released under the MIT License.

has loaded